C25H36N4O7S — CID 46192409
[4-(diaminomethylideneamino)phenyl] (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;4-methylbenzenesulfonic acid (PubChem CID 46192409) has the molecular formula C25H36N4O7S and a molecular weight of 536.65 g/mol. Its IUPAC name is [4-(diaminomethylideneamino)phenyl] (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;4-methylbenzenesulfonic acid.
| Compound Name | [4-(diaminomethylideneamino)phenyl] (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 46192409 |
| Molecular Formula | C25H36N4O7S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | [4-(diaminomethylideneamino)phenyl] (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate;4-methylbenzenesulfonic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc(N=C(N)N)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H28N4O4.C7H8O3S/c1-11(2)10-14(22-17(24)26-18(3,4)5)15(23)25-13-8-6-12(7-9-13)21-16(19)20;1-6-2-4-7(5-3-6)11(8,9)10/h6-9,11,14H,10H2,1-5H3,(H,22,24)(H4,19,20,21);2-5H,1H3,(H,8,9,10)/t14-;/m0./s1 |
| InChIKey | XOBRODFJDBKRKX-UQKRIMTDSA-N |
| XLogP | 3.68 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|