C17H25N5O5 — CID 10833572
[4-(diaminomethylideneamino)phenyl] 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate (PubChem CID 10833572) has the molecular formula C17H25N5O5 and a molecular weight of 379.42 g/mol. Its IUPAC name is [4-(diaminomethylideneamino)phenyl] 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate.
| Compound Name | [4-(diaminomethylideneamino)phenyl] 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 10833572 |
| Molecular Formula | C17H25N5O5 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [4-(diaminomethylideneamino)phenyl] 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)Oc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C17H25N5O5/c1-10(21-16(25)27-17(2,3)4)14(24)20-9-13(23)26-12-7-5-11(6-8-12)22-15(18)19/h5-8,10H,9H2,1-4H3,(H,20,24)(H,21,25)(H4,18,19,22)/t10-/m1/s1 |
| InChIKey | HCECVLQQNDJBJZ-SNVBAGLBSA-N |
| XLogP | 0.53 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|