C12H22N2O3 — CID 57088208
tert-butyl N-[1-(2-methylprop-2-enylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 57088208) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methylprop-2-enylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methylprop-2-enylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 57088208 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl N-[1-(2-methylprop-2-enylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | C=C(C)CNC(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-8(2)7-13-10(15)9(3)14-11(16)17-12(4,5)6/h9H,1,7H2,2-6H3,(H,13,15)(H,14,16) |
| InChIKey | AHHYANDDRZKFFS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|