C21H34N4O9 — CID 101251806
2-[2-[[(2S)-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoyl]amino]acetyl]oxyethyl 2-methylprop-2-enoate (PubChem CID 101251806) has the molecular formula C21H34N4O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-[2-[[(2S)-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoyl]amino]acetyl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[[(2S)-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoyl]amino]acetyl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101251806 |
| Molecular Formula | C21H34N4O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[2-[[(2S)-2-[[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]propanoyl]amino]acetyl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CNC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N4O9/c1-12(2)19(30)33-9-8-32-16(27)11-23-17(28)13(3)24-15(26)10-22-18(29)14(4)25-20(31)34-21(5,6)7/h13-14H,1,8-11H2,2-7H3,(H,22,29)(H,23,28)(H,24,26)(H,25,31)/t13-,14-/m0/s1 |
| InChIKey | CSGUUYQUCDBBAL-KBPBESRZSA-N |
| XLogP | -0.70 |
| TPSA | 178.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|