About (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate
(4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 137320625) has the molecular formula C13H16ClNO4
and a molecular weight of 285.73 g/mol. Its IUPAC name is (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| PubChem CID | 137320625 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO4/c1-13(2,3)19-12(17)15-8-11(16)18-10-6-4-9(14)5-7-10/h4-7H,8H2,1-3H3,(H,15,17) |
| InChIKey | INKHPWTWHNRHGN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The IUPAC name of (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CID 137320625) is (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
What is the SMILES notation for (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The canonical SMILES for (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate is CC(C)(C)OC(=O)NCC(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
The InChIKey is INKHPWTWHNRHGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO4/c1-13(2,3)19-12(17)15-8-11(16)18-10-6-4-9(14)5-7-10/h4-7H,8H2,1-3H3,(H,15,17).
What are the key properties of (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate?
(4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate has a molecular weight of 285.73 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate is sourced from PubChem (CID 137320625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).