C16H21NO5 — CID 9043385
(4-acetylphenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 9043385) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is (4-acetylphenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (4-acetylphenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 9043385 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (4-acetylphenyl) 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(=O)c1ccc(OC(=O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H21NO5/c1-11(18)12-5-7-13(8-6-12)21-14(19)9-10-17-15(20)22-16(2,3)4/h5-8H,9-10H2,1-4H3,(H,17,20) |
| InChIKey | IZKHYYPAKFTCQD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|