C19H27NO7 — CID 163253751
3-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoyloxy]phenyl]propanoic acid (PubChem CID 163253751) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoyloxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoyloxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 163253751 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoyloxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCCC(=O)Oc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C19H27NO7/c1-19(2,3)27-18(24)20-11-13-25-12-10-17(23)26-15-7-4-14(5-8-15)6-9-16(21)22/h4-5,7-8H,6,9-13H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | MBCOANZVHYZWFX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|