About [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate
[4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate (PubChem CID 163254088) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate.
Molecular Properties
| Compound Name | [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate |
| PubChem CID | 163254088 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate |
| SMILES | CNCCOCCC(=O)Oc1ccc(CCC(C)=O)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-13(18)3-4-14-5-7-15(8-6-14)21-16(19)9-11-20-12-10-17-2/h5-8,17H,3-4,9-12H2,1-2H3 |
| InChIKey | ZMDAFVMAGJDYBA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate?
The IUPAC name of [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate (CID 163254088) is [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate.
What is the SMILES notation for [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate?
The canonical SMILES for [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate is CNCCOCCC(=O)Oc1ccc(CCC(C)=O)cc1.
What is the InChIKey of [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate?
The InChIKey is ZMDAFVMAGJDYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-13(18)3-4-14-5-7-15(8-6-14)21-16(19)9-11-20-12-10-17-2/h5-8,17H,3-4,9-12H2,1-2H3.
What are the key properties of [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate?
[4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate has a molecular weight of 293.36 g/mol, XLogP of 1.74, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-oxobutyl)phenyl] 3-[2-(methylamino)ethoxy]propanoate is sourced from PubChem (CID 163254088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).