C26H35NO5 — CID 175713513
3-[4-[2-ethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]phenyl]propanoic acid (PubChem CID 175713513) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 3-[4-[2-ethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-ethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175713513 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 3-[4-[2-ethyl-4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]phenyl]propanoic acid |
| SMILES | CCc1cc(OCCCCNC(=O)OC(C)(C)C)ccc1-c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C26H35NO5/c1-5-20-18-22(31-17-7-6-16-27-25(30)32-26(2,3)4)13-14-23(20)21-11-8-19(9-12-21)10-15-24(28)29/h8-9,11-14,18H,5-7,10,15-17H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | NHDIHYLMRYCGRB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|