C21H25N3O3 — CID 175924058
3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]propanoic acid (PubChem CID 175924058) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175924058 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]propanoic acid |
| SMILES | CCc1cc(OCCCCN=[N+]=[N-])ccc1-c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-2-17-15-19(27-14-4-3-13-23-24-22)10-11-20(17)18-8-5-16(6-9-18)7-12-21(25)26/h5-6,8-11,15H,2-4,7,12-14H2,1H3,(H,25,26) |
| InChIKey | CASPKOPPKMZAOG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|