C28H36N2O2S — CID 165055953
(2S)-2-amino-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]-N-phenylpropanamide;sulfane (PubChem CID 165055953) has the molecular formula C28H36N2O2S and a molecular weight of 464.68 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]-N-phenylpropanamide;sulfane.
| Compound Name | (2S)-2-amino-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]-N-phenylpropanamide;sulfane |
|---|---|
| PubChem CID | 165055953 |
| Molecular Formula | C28H36N2O2S |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (2S)-2-amino-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]-N-phenylpropanamide;sulfane |
| SMILES | CCCCCOc1ccc(-c2ccc(C[C@H](N)C(=O)Nc3ccccc3)cc2)c(CC)c1.S |
| InChI | InChI=1S/C28H34N2O2.H2S/c1-3-5-9-18-32-25-16-17-26(22(4-2)20-25)23-14-12-21(13-15-23)19-27(29)28(31)30-24-10-7-6-8-11-24;/h6-8,10-17,20,27H,3-5,9,18-19,29H2,1-2H3,(H,30,31);1H2/t27-;/m0./s1 |
| InChIKey | QKQFQSCPEXCYSV-YCBFMBTMSA-N |
| XLogP | 6.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|