C33H44N4O4 — CID 162757928
5-[4-(4-aminobutoxy)phenyl]-2-[[(2S)-2-amino-3-[4-(2-ethyl-4-methoxyphenyl)phenyl]propanoyl]amino]pentanamide (PubChem CID 162757928) has the molecular formula C33H44N4O4 and a molecular weight of 560.74 g/mol. Its IUPAC name is 5-[4-(4-aminobutoxy)phenyl]-2-[[(2S)-2-amino-3-[4-(2-ethyl-4-methoxyphenyl)phenyl]propanoyl]amino]pentanamide.
| Compound Name | 5-[4-(4-aminobutoxy)phenyl]-2-[[(2S)-2-amino-3-[4-(2-ethyl-4-methoxyphenyl)phenyl]propanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 162757928 |
| Molecular Formula | C33H44N4O4 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 5-[4-(4-aminobutoxy)phenyl]-2-[[(2S)-2-amino-3-[4-(2-ethyl-4-methoxyphenyl)phenyl]propanoyl]amino]pentanamide |
| SMILES | CCc1cc(OC)ccc1-c1ccc(C[C@H](N)C(=O)NC(CCCc2ccc(OCCCCN)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C33H44N4O4/c1-3-25-22-28(40-2)17-18-29(25)26-13-9-24(10-14-26)21-30(35)33(39)37-31(32(36)38)8-6-7-23-11-15-27(16-12-23)41-20-5-4-19-34/h9-18,22,30-31H,3-8,19-21,34-35H2,1-2H3,(H2,36,38)(H,37,39)/t30-,31?/m0/s1 |
| InChIKey | WPBDFKDWXNFQBC-FSRLHOSWSA-N |
| XLogP | 3.91 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|