C41H55N5O6 — CID 162757920
N-[(2S)-3-[4-[4-(4-aminobutoxy)-2-ethylphenyl]phenyl]-1-[5-(3,5-dimethylphenyl)pentan-2-ylamino]-1-oxopropan-2-yl]-2-[(2-formamidoacetyl)amino]-4-oxobutanamide (PubChem CID 162757920) has the molecular formula C41H55N5O6 and a molecular weight of 713.92 g/mol. Its IUPAC name is N-[(2S)-3-[4-[4-(4-aminobutoxy)-2-ethylphenyl]phenyl]-1-[5-(3,5-dimethylphenyl)pentan-2-ylamino]-1-oxopropan-2-yl]-2-[(2-formamidoacetyl)amino]-4-oxobutanamide.
| Compound Name | N-[(2S)-3-[4-[4-(4-aminobutoxy)-2-ethylphenyl]phenyl]-1-[5-(3,5-dimethylphenyl)pentan-2-ylamino]-1-oxopropan-2-yl]-2-[(2-formamidoacetyl)amino]-4-oxobutanamide |
|---|---|
| PubChem CID | 162757920 |
| Molecular Formula | C41H55N5O6 |
| Molecular Weight | 713.92 g/mol |
| Exact Mass | 713.42 |
| IUPAC Name | N-[(2S)-3-[4-[4-(4-aminobutoxy)-2-ethylphenyl]phenyl]-1-[5-(3,5-dimethylphenyl)pentan-2-ylamino]-1-oxopropan-2-yl]-2-[(2-formamidoacetyl)amino]-4-oxobutanamide |
| SMILES | CCc1cc(OCCCCN)ccc1-c1ccc(C[C@H](NC(=O)C(CC=O)NC(=O)CNC=O)C(=O)NC(C)CCCc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C41H55N5O6/c1-5-33-25-35(52-20-7-6-18-42)15-16-36(33)34-13-11-31(12-14-34)24-38(46-40(50)37(17-19-47)45-39(49)26-43-27-48)41(51)44-30(4)9-8-10-32-22-28(2)21-29(3)23-32/h11-16,19,21-23,25,27,30,37-38H,5-10,17-18,20,24,26,42H2,1-4H3,(H,43,48)(H,44,51)(H,45,49)(H,46,50)/t30?,37?,38-/m0/s1 |
| InChIKey | DTHYTJBFKWZOSY-LXILLEILSA-N |
| XLogP | 4.03 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|