C16H24N4O4 — CID 175180688
[(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate (PubChem CID 175180688) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate.
| Compound Name | [(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate |
|---|---|
| PubChem CID | 175180688 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate |
| SMILES | NC(=O)OCCCC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H24N4O4/c17-12(10-11-6-2-1-3-7-11)15(22)20-13(14(18)21)8-4-5-9-24-16(19)23/h1-3,6-7,12-13H,4-5,8-10,17H2,(H2,18,21)(H2,19,23)(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | ARBDZUSCQHVSQY-STQMWFEESA-N |
| XLogP | -0.21 |
| TPSA | 150.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|