C22H38N8O4 — CID 175180945
[6-amino-5-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate (PubChem CID 175180945) has the molecular formula C22H38N8O4 and a molecular weight of 478.60 g/mol. Its IUPAC name is [6-amino-5-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate.
| Compound Name | [6-amino-5-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate |
|---|---|
| PubChem CID | 175180945 |
| Molecular Formula | C22H38N8O4 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | [6-amino-5-[[2-[[2-amino-5-(diaminomethylideneamino)pentyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl] carbamate |
| SMILES | NC(=O)OCCCCC(NC(=O)C(Cc1ccccc1)NCC(N)CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C22H38N8O4/c23-16(9-6-11-28-21(25)26)14-29-18(13-15-7-2-1-3-8-15)20(32)30-17(19(24)31)10-4-5-12-34-22(27)33/h1-3,7-8,16-18,29H,4-6,9-14,23H2,(H2,24,31)(H2,27,33)(H,30,32)(H4,25,26,28) |
| InChIKey | XUEQJIMJBAHXLI-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 226.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|