C25H39NO2 — CID 143874783
3-(dimethylamino)-4-[4-(2-ethyl-4-methoxyphenyl)phenyl]butan-2-one;ethane (PubChem CID 143874783) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is 3-(dimethylamino)-4-[4-(2-ethyl-4-methoxyphenyl)phenyl]butan-2-one;ethane.
| Compound Name | 3-(dimethylamino)-4-[4-(2-ethyl-4-methoxyphenyl)phenyl]butan-2-one;ethane |
|---|---|
| PubChem CID | 143874783 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | 3-(dimethylamino)-4-[4-(2-ethyl-4-methoxyphenyl)phenyl]butan-2-one;ethane |
| SMILES | CC.CC.CCc1cc(OC)ccc1-c1ccc(CC(C(C)=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H27NO2.2C2H6/c1-6-17-14-19(24-5)11-12-20(17)18-9-7-16(8-10-18)13-21(15(2)23)22(3)4;2*1-2/h7-12,14,21H,6,13H2,1-5H3;2*1-2H3 |
| InChIKey | FDQGAHIDHKKMEG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |