C24H32O2 — CID 143874775
ethane;2-ethyl-2-[[4-(2-ethyl-4-methoxyphenyl)phenyl]methyl]cyclobutan-1-one (PubChem CID 143874775) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is ethane;2-ethyl-2-[[4-(2-ethyl-4-methoxyphenyl)phenyl]methyl]cyclobutan-1-one.
| Compound Name | ethane;2-ethyl-2-[[4-(2-ethyl-4-methoxyphenyl)phenyl]methyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 143874775 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ethane;2-ethyl-2-[[4-(2-ethyl-4-methoxyphenyl)phenyl]methyl]cyclobutan-1-one |
| SMILES | CC.CCc1cc(OC)ccc1-c1ccc(CC2(CC)CCC2=O)cc1 |
| InChI | InChI=1S/C22H26O2.C2H6/c1-4-17-14-19(24-3)10-11-20(17)18-8-6-16(7-9-18)15-22(5-2)13-12-21(22)23;1-2/h6-11,14H,4-5,12-13,15H2,1-3H3;1-2H3 |
| InChIKey | JBURJEKEBNIYTH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |