C15H20O2 — CID 18180234
4,4-diethyl-7-methoxy-2,3-dihydronaphthalen-1-one (PubChem CID 18180234) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,4-diethyl-7-methoxy-2,3-dihydronaphthalen-1-one.
| Compound Name | 4,4-diethyl-7-methoxy-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 18180234 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 4,4-diethyl-7-methoxy-2,3-dihydronaphthalen-1-one |
| SMILES | CCC1(CC)CCC(=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C15H20O2/c1-4-15(5-2)9-8-14(16)12-10-11(17-3)6-7-13(12)15/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | IWXLHDGGQZBJQX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |