C14H20N2O2 — CID 113308841
3,3-diethyl-7-methoxy-4,5-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 113308841) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3,3-diethyl-7-methoxy-4,5-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | 3,3-diethyl-7-methoxy-4,5-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 113308841 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3,3-diethyl-7-methoxy-4,5-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | CCC1(CC)CNc2cc(OC)ccc2NC1=O |
| InChI | InChI=1S/C14H20N2O2/c1-4-14(5-2)9-15-12-8-10(18-3)6-7-11(12)16-13(14)17/h6-8,15H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | VWQULOMAWQXWBU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |