C11H15NO3S — CID 84630049
7-methoxy-2,2-dimethyl-3,4-dihydro-1λ6,4-benzothiazine 1,1-dioxide (PubChem CID 84630049) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-3,4-dihydro-1λ6,4-benzothiazine 1,1-dioxide.
| Compound Name | 7-methoxy-2,2-dimethyl-3,4-dihydro-1λ6,4-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 84630049 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-3,4-dihydro-1λ6,4-benzothiazine 1,1-dioxide |
| SMILES | COc1ccc2c(c1)S(=O)(=O)C(C)(C)CN2 |
| InChI | InChI=1S/C11H15NO3S/c1-11(2)7-12-9-5-4-8(15-3)6-10(9)16(11,13)14/h4-6,12H,7H2,1-3H3 |
| InChIKey | FLFJGLFQLXOWTN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|