C11H14FNO — CID 84720514
3-fluoro-7-methoxy-3-methyl-2,4-dihydro-1H-quinoline (PubChem CID 84720514) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 3-fluoro-7-methoxy-3-methyl-2,4-dihydro-1H-quinoline.
| Compound Name | 3-fluoro-7-methoxy-3-methyl-2,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 84720514 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3-fluoro-7-methoxy-3-methyl-2,4-dihydro-1H-quinoline |
| SMILES | COc1ccc2c(c1)NCC(C)(F)C2 |
| InChI | InChI=1S/C11H14FNO/c1-11(12)6-8-3-4-9(14-2)5-10(8)13-7-11/h3-5,13H,6-7H2,1-2H3 |
| InChIKey | DVRCDNZTMKGBQI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |