C14H17F2NO — CID 106701810
4',4'-difluoro-5-methoxyspiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 106701810) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 4',4'-difluoro-5-methoxyspiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | 4',4'-difluoro-5-methoxyspiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 106701810 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4',4'-difluoro-5-methoxyspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | COc1ccc2c(c1)C1(CCC(F)(F)CC1)CN2 |
| InChI | InChI=1S/C14H17F2NO/c1-18-10-2-3-12-11(8-10)13(9-17-12)4-6-14(15,16)7-5-13/h2-3,8,17H,4-7,9H2,1H3 |
| InChIKey | VEXFYGOLQNCURH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|