C16H24N2O — CID 169244448
5-methoxy-3-methyl-3-(1-methylpiperidin-4-yl)-1,2-dihydroindole (PubChem CID 169244448) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-methoxy-3-methyl-3-(1-methylpiperidin-4-yl)-1,2-dihydroindole.
| Compound Name | 5-methoxy-3-methyl-3-(1-methylpiperidin-4-yl)-1,2-dihydroindole |
|---|---|
| PubChem CID | 169244448 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-methoxy-3-methyl-3-(1-methylpiperidin-4-yl)-1,2-dihydroindole |
| SMILES | COc1ccc2c(c1)C(C)(C1CCN(C)CC1)CN2 |
| InChI | InChI=1S/C16H24N2O/c1-16(12-6-8-18(2)9-7-12)11-17-15-5-4-13(19-3)10-14(15)16/h4-5,10,12,17H,6-9,11H2,1-3H3 |
| InChIKey | GFWKXNNFAQYWTP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|