C18H27NO2 — CID 58950918
6-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol (PubChem CID 58950918) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 6-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol.
| Compound Name | 6-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol |
|---|---|
| PubChem CID | 58950918 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 6-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol |
| SMILES | COc1ccc2c(c1)C(O)(C1CCN(C)CC1)C(C)(C)C2 |
| InChI | InChI=1S/C18H27NO2/c1-17(2)12-13-5-6-15(21-4)11-16(13)18(17,20)14-7-9-19(3)10-8-14/h5-6,11,14,20H,7-10,12H2,1-4H3 |
| InChIKey | CDDUNQWEZXZPBW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |