About 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol
5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol (PubChem CID 58951100) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol |
| PubChem CID | 58951100 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol |
| SMILES | COc1cccc2c1CCC(C)(C)C2(O)C1CCN(C)CC1 |
| InChI | InChI=1S/C19H29NO2/c1-18(2)11-8-15-16(6-5-7-17(15)22-4)19(18,21)14-9-12-20(3)13-10-14/h5-7,14,21H,8-13H2,1-4H3 |
| InChIKey | CNCMDFROMMWUHG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol?
The IUPAC name of 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol (CID 58951100) is 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol.
What is the SMILES notation for 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol?
The canonical SMILES for 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol is COc1cccc2c1CCC(C)(C)C2(O)C1CCN(C)CC1.
What is the InChIKey of 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol?
The InChIKey is CNCMDFROMMWUHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO2/c1-18(2)11-8-15-16(6-5-7-17(15)22-4)19(18,21)14-9-12-20(3)13-10-14/h5-7,14,21H,8-13H2,1-4H3.
What are the key properties of 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol?
5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol has a molecular weight of 303.45 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3,4-dihydronaphthalen-1-ol is sourced from PubChem (CID 58951100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).