C19H25FN2O2 — CID 58951142
4-fluoro-6-isocyano-7-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol (PubChem CID 58951142) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 4-fluoro-6-isocyano-7-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol.
| Compound Name | 4-fluoro-6-isocyano-7-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol |
|---|---|
| PubChem CID | 58951142 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-fluoro-6-isocyano-7-methoxy-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol |
| SMILES | [C-]#[N+]c1cc(F)c2c(c1OC)C(O)(C1CCN(C)CC1)C(C)(C)C2 |
| InChI | InChI=1S/C19H25FN2O2/c1-18(2)11-13-14(20)10-15(21-3)17(24-5)16(13)19(18,23)12-6-8-22(4)9-7-12/h10,12,23H,6-9,11H2,1-2,4-5H3 |
| InChIKey | DVDIEILAOXANLS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|