C22H27FN2O5 — CID 69350206
but-2-enedioic acid;7-fluoro-3-hydroxy-2,2-dimethyl-3-(1-methylpiperidin-4-yl)-1H-indene-4-carbonitrile (PubChem CID 69350206) has the molecular formula C22H27FN2O5 and a molecular weight of 418.47 g/mol. Its IUPAC name is but-2-enedioic acid;7-fluoro-3-hydroxy-2,2-dimethyl-3-(1-methylpiperidin-4-yl)-1H-indene-4-carbonitrile.
| Compound Name | but-2-enedioic acid;7-fluoro-3-hydroxy-2,2-dimethyl-3-(1-methylpiperidin-4-yl)-1H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 69350206 |
| Molecular Formula | C22H27FN2O5 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | but-2-enedioic acid;7-fluoro-3-hydroxy-2,2-dimethyl-3-(1-methylpiperidin-4-yl)-1H-indene-4-carbonitrile |
| SMILES | CN1CCC(C2(O)c3c(C#N)ccc(F)c3CC2(C)C)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H23FN2O.C4H4O4/c1-17(2)10-14-15(19)5-4-12(11-20)16(14)18(17,22)13-6-8-21(3)9-7-13;5-3(6)1-2-4(7)8/h4-5,13,22H,6-10H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JZVJARUZCIPKRJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|