C17H23Cl2NO — CID 58950978
5,6-dichloro-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol (PubChem CID 58950978) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is 5,6-dichloro-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol.
| Compound Name | 5,6-dichloro-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol |
|---|---|
| PubChem CID | 58950978 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5,6-dichloro-2,2-dimethyl-1-(1-methylpiperidin-4-yl)-3H-inden-1-ol |
| SMILES | CN1CCC(C2(O)c3cc(Cl)c(Cl)cc3CC2(C)C)CC1 |
| InChI | InChI=1S/C17H23Cl2NO/c1-16(2)10-11-8-14(18)15(19)9-13(11)17(16,21)12-4-6-20(3)7-5-12/h8-9,12,21H,4-7,10H2,1-3H3 |
| InChIKey | GMXUMUVRXCCWGB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |