C17H25NO — CID 21436183
7-methoxy-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline (PubChem CID 21436183) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 7-methoxy-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline.
| Compound Name | 7-methoxy-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline |
|---|---|
| PubChem CID | 21436183 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 7-methoxy-1,5,5-trimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline |
| SMILES | COc1ccc2c(c1)C(C)(C)C1CCCN(C)C1C2 |
| InChI | InChI=1S/C17H25NO/c1-17(2)14-6-5-9-18(3)16(14)10-12-7-8-13(19-4)11-15(12)17/h7-8,11,14,16H,5-6,9-10H2,1-4H3 |
| InChIKey | JHGXVHLVQMXIGA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |