C19H27NO — CID 22212557
(1R,9R,10R,13S)-4-methoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 22212557) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (1R,9R,10R,13S)-4-methoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10R,13S)-4-methoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 22212557 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (1R,9R,10R,13S)-4-methoxy-13,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]13CCN(C)[C@H](C2)[C@@H]1CC[C@H](C)C3 |
| InChI | InChI=1S/C19H27NO/c1-13-4-7-16-18-10-14-5-6-15(21-3)11-17(14)19(16,12-13)8-9-20(18)2/h5-6,11,13,16,18H,4,7-10,12H2,1-3H3/t13-,16-,18+,19-/m0/s1 |
| InChIKey | NJSYSXOOQOVPHA-IVJVFBROSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |