C19H26N2O2 — CID 118583907
1-[(1S,9R,10S)-4-methoxy-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]ethanone (PubChem CID 118583907) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(1S,9R,10S)-4-methoxy-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]ethanone.
| Compound Name | 1-[(1S,9R,10S)-4-methoxy-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]ethanone |
|---|---|
| PubChem CID | 118583907 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[(1S,9R,10S)-4-methoxy-17-methyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]ethanone |
| SMILES | COc1ccc2c(c1)[C@@]13CCN(C(C)=O)C[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C19H26N2O2/c1-13(22)21-9-7-19-6-8-20(2)18(17(19)12-21)10-14-4-5-15(23-3)11-16(14)19/h4-5,11,17-18H,6-10,12H2,1-3H3/t17-,18+,19+/m0/s1 |
| InChIKey | SNNHNVUTPCGORL-IPMKNSEASA-N |
| XLogP | 2.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |