C21H28N2O — CID 129039986
cyclopropyl-[(1S,9R,10S)-4,17-dimethyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]methanone (PubChem CID 129039986) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is cyclopropyl-[(1S,9R,10S)-4,17-dimethyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]methanone.
| Compound Name | cyclopropyl-[(1S,9R,10S)-4,17-dimethyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]methanone |
|---|---|
| PubChem CID | 129039986 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | cyclopropyl-[(1S,9R,10S)-4,17-dimethyl-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-12-yl]methanone |
| SMILES | Cc1ccc2c(c1)[C@@]13CCN(C(=O)C4CC4)C[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C21H28N2O/c1-14-3-4-16-12-19-18-13-23(20(24)15-5-6-15)10-8-21(18,17(16)11-14)7-9-22(19)2/h3-4,11,15,18-19H,5-10,12-13H2,1-2H3/t18-,19+,21+/m0/s1 |
| InChIKey | SIBICDXUHDEZHG-QKNQBKEWSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |