C22H30N2O8 — CID 158743909
(1R,9R,10R)-N,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine;oxalic acid (PubChem CID 158743909) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is (1R,9R,10R)-N,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine;oxalic acid.
| Compound Name | (1R,9R,10R)-N,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine;oxalic acid |
|---|---|
| PubChem CID | 158743909 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (1R,9R,10R)-N,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine;oxalic acid |
| SMILES | CNc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C)CC3.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26N2.2C2H2O4/c1-19-14-7-6-13-11-17-15-5-3-4-8-18(15,16(13)12-14)9-10-20(17)2;2*3-1(4)2(5)6/h6-7,12,15,17,19H,3-5,8-11H2,1-2H3;2*(H,3,4)(H,5,6)/t15-,17+,18+;;/m0../s1 |
| InChIKey | IMQJFRGWFLHGOP-AZVNSBTFSA-N |
| XLogP | 1.73 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|