C18H25NO — CID 68916875
[(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanol (PubChem CID 68916875) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is [(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanol.
| Compound Name | [(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanol |
|---|---|
| PubChem CID | 68916875 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | [(1S,9S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanol |
| SMILES | CN1CC[C@@]23CCCCC2[C@@H]1Cc1ccc(CO)cc13 |
| InChI | InChI=1S/C18H25NO/c1-19-9-8-18-7-3-2-4-15(18)17(19)11-14-6-5-13(12-20)10-16(14)18/h5-6,10,15,17,20H,2-4,7-9,11-12H2,1H3/t15?,17-,18-/m0/s1 |
| InChIKey | LMGBPRILLFAAJB-BEEDKBRMSA-N |
| XLogP | 2.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |