C18H28NO4P — CID 5492722
(1S,9R,10S)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;phosphoric acid (PubChem CID 5492722) has the molecular formula C18H28NO4P and a molecular weight of 353.40 g/mol. Its IUPAC name is (1S,9R,10S)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;phosphoric acid.
| Compound Name | (1S,9R,10S)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;phosphoric acid |
|---|---|
| PubChem CID | 5492722 |
| Molecular Formula | C18H28NO4P |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (1S,9R,10S)-4,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;phosphoric acid |
| SMILES | Cc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@@H](C2)N(C)CC3.O=P(O)(O)O |
| InChI | InChI=1S/C18H25N.H3O4P/c1-13-6-7-14-12-17-15-5-3-4-8-18(15,16(14)11-13)9-10-19(17)2;1-5(2,3)4/h6-7,11,15,17H,3-5,8-10,12H2,1-2H3;(H3,1,2,3,4)/t15-,17-,18+;/m1./s1 |
| InChIKey | ODJHDWLIOUGPPA-ZDJZOQRLSA-N |
| XLogP | 2.75 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|