C17H24N2 — CID 23315065
(1R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 23315065) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 23315065 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (1R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | CN1CC[C@]23CCCCC2C1Cc1ccc(N)cc13 |
| InChI | InChI=1S/C17H24N2/c1-19-9-8-17-7-3-2-4-14(17)16(19)10-12-5-6-13(18)11-15(12)17/h5-6,11,14,16H,2-4,7-10,18H2,1H3/t14?,16?,17-/m1/s1 |
| InChIKey | CYPHSPITDGFDMD-BDVYOWHSSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|