C20H31NOSi — CID 57362227
trimethyl-[[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]silane (PubChem CID 57362227) has the molecular formula C20H31NOSi and a molecular weight of 329.56 g/mol. Its IUPAC name is trimethyl-[[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]silane.
| Compound Name | trimethyl-[[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]silane |
|---|---|
| PubChem CID | 57362227 |
| Molecular Formula | C20H31NOSi |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | trimethyl-[[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]silane |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(O[Si](C)(C)C)cc13 |
| InChI | InChI=1S/C20H31NOSi/c1-21-12-11-20-10-6-5-7-17(20)19(21)13-15-8-9-16(14-18(15)20)22-23(2,3)4/h8-9,14,17,19H,5-7,10-13H2,1-4H3/t17-,19+,20+/m0/s1 |
| InChIKey | SMNMCZXTILNDLC-DFQSSKMNSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|