C18H24BNO — CID 156874487
CID 156874487 (PubChem CID 156874487) has the molecular formula C18H24BNO and a molecular weight of 281.21 g/mol.
| Compound Name | CID 156874487 |
|---|---|
| PubChem CID | 156874487 |
| Molecular Formula | C18H24BNO |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc2c(c1)[C@]13CCCCC1[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C18H24BNO/c1-20-9-8-18-7-3-2-4-15(18)17(20)10-13-5-6-14(21-12-19)11-16(13)18/h5-6,11,15,17H,2-4,7-10,12H2,1H3/t15?,17-,18-/m0/s1 |
| InChIKey | HSUJMAMTCNHGEK-BEEDKBRMSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|