C24H29NO — CID 15934564
(1R,9R,10R)-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 15934564) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (1R,9R,10R)-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10R)-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 15934564 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (1R,9R,10R)-17-methyl-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(OCc2ccccc2)cc13 |
| InChI | InChI=1S/C24H29NO/c1-25-14-13-24-12-6-5-9-21(24)23(25)15-19-10-11-20(16-22(19)24)26-17-18-7-3-2-4-8-18/h2-4,7-8,10-11,16,21,23H,5-6,9,12-15,17H2,1H3/t21-,23+,24+/m0/s1 |
| InChIKey | IFDCSWVGBHHTOK-QPTUXGOLSA-N |
| XLogP | 4.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |