C19H27NO — CID 88572586
(1S,10R)-4-(1,1-dideuterioethoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 88572586) has the molecular formula C19H27NO and a molecular weight of 287.44 g/mol. Its IUPAC name is (1S,10R)-4-(1,1-dideuterioethoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1S,10R)-4-(1,1-dideuterioethoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 88572586 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (1S,10R)-4-(1,1-dideuterioethoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | [2H]C([2H])(C)Oc1ccc2c(c1)[C@]13CCCC[C@H]1C(C2)N(C)CC3 |
| InChI | InChI=1S/C19H27NO/c1-3-21-15-8-7-14-12-18-16-6-4-5-9-19(16,17(14)13-15)10-11-20(18)2/h7-8,13,16,18H,3-6,9-12H2,1-2H3/t16-,18?,19-/m0/s1/i3D2 |
| InChIKey | DIWAJQNYTVAWMY-KYIZSTJFSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |