C19H25NO2 — CID 71283379
2-[(1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid (PubChem CID 71283379) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-[(1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid.
| Compound Name | 2-[(1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid |
|---|---|
| PubChem CID | 71283379 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-[(1R,9R,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid |
| SMILES | CN1CC[C@]23CCCC[C@@H]2[C@H]1Cc1ccc(CC(=O)O)cc13 |
| InChI | InChI=1S/C19H25NO2/c1-20-9-8-19-7-3-2-4-15(19)17(20)12-14-6-5-13(10-16(14)19)11-18(21)22/h5-6,10,15,17H,2-4,7-9,11-12H2,1H3,(H,21,22)/t15-,17-,19-/m1/s1 |
| InChIKey | UDOKHNQFFVBMKX-SZVBFZGTSA-N |
| XLogP | 3.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |