C19H27N — CID 88572599
(1S,10R)-4-(1,1,2,2,2-pentadeuterioethyl)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 88572599) has the molecular formula C19H27N and a molecular weight of 277.48 g/mol. Its IUPAC name is (1S,10R)-4-(1,1,2,2,2-pentadeuterioethyl)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1S,10R)-4-(1,1,2,2,2-pentadeuterioethyl)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 88572599 |
| Molecular Formula | C19H27N |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.26 |
| IUPAC Name | (1S,10R)-4-(1,1,2,2,2-pentadeuterioethyl)-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | [2H]C([2H])([2H])N1CC[C@@]23CCCC[C@H]2C1Cc1ccc(C([2H])([2H])C([2H])([2H])[2H])cc13 |
| InChI | InChI=1S/C19H27N/c1-3-14-7-8-15-13-18-16-6-4-5-9-19(16,17(15)12-14)10-11-20(18)2/h7-8,12,16,18H,3-6,9-11,13H2,1-2H3/t16-,18?,19-/m0/s1/i1D3,2D3,3D2 |
| InChIKey | XTANUSAPYBBGOF-HJIHLUNSSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |