C19H28N2 — CID 155312970
N-methyl-1-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanamine (PubChem CID 155312970) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-methyl-1-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanamine.
| Compound Name | N-methyl-1-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanamine |
|---|---|
| PubChem CID | 155312970 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-methyl-1-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]methanamine |
| SMILES | CNCc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C19H28N2/c1-20-13-14-6-7-15-12-18-16-5-3-4-8-19(16,17(15)11-14)9-10-21(18)2/h6-7,11,16,18,20H,3-5,8-10,12-13H2,1-2H3/t16-,18+,19+/m0/s1 |
| InChIKey | RPTRSZJPVUIJII-QXAKKESOSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |