C19H24F3NO3 — CID 76973205
17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;2,2,2-trifluoroacetic acid (PubChem CID 76973205) has the molecular formula C19H24F3NO3 and a molecular weight of 374.42 g/mol. Its IUPAC name is 17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 76973205 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[2H]C([2H])([2H])N1CCC23CCCCC2C1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H23NO.C2HF3O2/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17;3-2(4,5)1(6)7/h5-6,11,14,16,19H,2-4,7-10H2,1H3;(H,6,7)/i1D3; |
| InChIKey | PJSZRAVIIWQLIP-NIIDSAIPSA-N |
| XLogP | 3.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |