C29H33F3N2O4 — CID 175703921
(1R)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175703921) has the molecular formula C29H33F3N2O4 and a molecular weight of 530.59 g/mol. Its IUPAC name is (1R)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1R)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175703921 |
| Molecular Formula | C29H33F3N2O4 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (1R)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1cc(NC(=O)[C@@H]2CC2c2ccc(O)cc2)ccc13.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H32N2O2.C2HF3O2/c1-29-13-12-27-11-3-2-4-24(27)25(29)15-18-14-19(7-10-23(18)27)28-26(31)22-16-21(22)17-5-8-20(30)9-6-17;3-2(4,5)1(6)7/h5-10,14,21-22,24-25,30H,2-4,11-13,15-16H2,1H3,(H,28,31);(H,6,7)/t21?,22-,24+,25-,27+;/m1./s1 |
| InChIKey | COUWODAHJOWPHH-SUKULSEMSA-N |
| XLogP | 5.46 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |