C21H31N3O2 — CID 122690097
1-(2-methoxyethyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea (PubChem CID 122690097) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea.
| Compound Name | 1-(2-methoxyethyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea |
|---|---|
| PubChem CID | 122690097 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea |
| SMILES | COCCNC(=O)Nc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C21H31N3O2/c1-24-11-9-21-8-4-3-5-17(21)19(24)13-15-6-7-16(14-18(15)21)23-20(25)22-10-12-26-2/h6-7,14,17,19H,3-5,8-13H2,1-2H3,(H2,22,23,25)/t17-,19+,21+/m0/s1 |
| InChIKey | RCYREOBORCBBRB-FBBABVLZSA-N |
| XLogP | 3.14 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|