C22H32N2O2 — CID 142456658
(17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl) 2-amino-3-methylbutanoate (PubChem CID 142456658) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl) 2-amino-3-methylbutanoate.
| Compound Name | (17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl) 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 142456658 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl) 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)Oc1ccc2c(c1)C13CCCCC1C(C2)N(C)CC3 |
| InChI | InChI=1S/C22H32N2O2/c1-14(2)20(23)21(25)26-16-8-7-15-12-19-17-6-4-5-9-22(17,18(15)13-16)10-11-24(19)3/h7-8,13-14,17,19-20H,4-6,9-12,23H2,1-3H3 |
| InChIKey | LWFFZPILAWOOEV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|