C25H36N2O3 — CID 177367017
[(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (2S,3S)-2-acetamido-3-methylpentanoate (PubChem CID 177367017) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (2S,3S)-2-acetamido-3-methylpentanoate.
| Compound Name | [(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (2S,3S)-2-acetamido-3-methylpentanoate |
|---|---|
| PubChem CID | 177367017 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | [(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] (2S,3S)-2-acetamido-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)Oc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C25H36N2O3/c1-5-16(2)23(26-17(3)28)24(29)30-19-10-9-18-14-22-20-8-6-7-11-25(20,21(18)15-19)12-13-27(22)4/h9-10,15-16,20,22-23H,5-8,11-14H2,1-4H3,(H,26,28)/t16-,20+,22-,23-,25-/m0/s1 |
| InChIKey | SMRVDWRJLLDFTR-LTXMZLJDSA-N |
| XLogP | 3.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|