C45H51N3O4 — CID 161072913
[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 5-[(2-amino-3-phenylpropanoyl)amino]-2-benzyl-4-oxo-6-phenylhexanoate (PubChem CID 161072913) has the molecular formula C45H51N3O4 and a molecular weight of 697.92 g/mol. Its IUPAC name is [(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 5-[(2-amino-3-phenylpropanoyl)amino]-2-benzyl-4-oxo-6-phenylhexanoate.
| Compound Name | [(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 5-[(2-amino-3-phenylpropanoyl)amino]-2-benzyl-4-oxo-6-phenylhexanoate |
|---|---|
| PubChem CID | 161072913 |
| Molecular Formula | C45H51N3O4 |
| Molecular Weight | 697.92 g/mol |
| Exact Mass | 697.39 |
| IUPAC Name | [(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 5-[(2-amino-3-phenylpropanoyl)amino]-2-benzyl-4-oxo-6-phenylhexanoate |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(OC(=O)C(CC(=O)C(Cc2ccccc2)NC(=O)C(N)Cc2ccccc2)Cc2ccccc2)cc13 |
| InChI | InChI=1S/C45H51N3O4/c1-48-24-23-45-22-12-11-19-37(45)41(48)28-34-20-21-36(30-38(34)45)52-44(51)35(25-31-13-5-2-6-14-31)29-42(49)40(27-33-17-9-4-10-18-33)47-43(50)39(46)26-32-15-7-3-8-16-32/h2-10,13-18,20-21,30,35,37,39-41H,11-12,19,22-29,46H2,1H3,(H,47,50)/t35?,37-,39?,40?,41+,45+/m0/s1 |
| InChIKey | UEWUJTCYQYBHRC-YSKIAWAOSA-N |
| XLogP | 6.40 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|