C26H36N2O6 — CID 142456795
[(1S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxycarbonyloxymethyl 2-acetamido-3-methylbutanoate (PubChem CID 142456795) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is [(1S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxycarbonyloxymethyl 2-acetamido-3-methylbutanoate.
| Compound Name | [(1S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxycarbonyloxymethyl 2-acetamido-3-methylbutanoate |
|---|---|
| PubChem CID | 142456795 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [(1S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxycarbonyloxymethyl 2-acetamido-3-methylbutanoate |
| SMILES | CC(=O)NC(C(=O)OCOC(=O)Oc1ccc2c(c1)[C@]13CCCC[C@@H]1C(C2)N(C)CC3)C(C)C |
| InChI | InChI=1S/C26H36N2O6/c1-16(2)23(27-17(3)29)24(30)32-15-33-25(31)34-19-9-8-18-13-22-20-7-5-6-10-26(20,21(18)14-19)11-12-28(22)4/h8-9,14,16,20,22-23H,5-7,10-13,15H2,1-4H3,(H,27,29)/t20-,22?,23?,26+/m1/s1 |
| InChIKey | FOVZVKQIALPBGC-WTIXNQEISA-N |
| XLogP | 3.55 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|